C20H31N3O2 — CID 16988910
N-[5-[1-(2-methoxyethyl)benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide (PubChem CID 16988910) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[5-[1-(2-methoxyethyl)benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-(2-methoxyethyl)benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16988910 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[5-[1-(2-methoxyethyl)benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
| SMILES | COCCn1c(CCCCCNC(=O)C(C)(C)C)nc2ccccc21 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,3)19(24)21-13-9-5-6-12-18-22-16-10-7-8-11-17(16)23(18)14-15-25-4/h7-8,10-11H,5-6,9,12-15H2,1-4H3,(H,21,24) |
| InChIKey | LEHBCXFSOSDBII-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|