C27H36ClN3O2 — CID 16988898
N-[5-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide (PubChem CID 16988898) has the molecular formula C27H36ClN3O2 and a molecular weight of 470.06 g/mol. Its IUPAC name is N-[5-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16988898 |
| Molecular Formula | C27H36ClN3O2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[5-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCCCc1nc2ccccc2n1CCCCOc1ccccc1Cl |
| InChI | InChI=1S/C27H36ClN3O2/c1-27(2,3)26(32)29-18-10-4-5-17-25-30-22-14-7-8-15-23(22)31(25)19-11-12-20-33-24-16-9-6-13-21(24)28/h6-9,13-16H,4-5,10-12,17-20H2,1-3H3,(H,29,32) |
| InChIKey | WLLXSWTZGGCAEV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|