C23H28ClN3O2 — CID 16975007
N-[2-[1-[3-(2-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 16975007) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[2-[1-[3-(2-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[1-[3-(2-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16975007 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[2-[1-[3-(2-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCc1nc2ccccc2n1CCCOc1ccccc1Cl |
| InChI | InChI=1S/C23H28ClN3O2/c1-23(2,3)22(28)25-14-13-21-26-18-10-5-6-11-19(18)27(21)15-8-16-29-20-12-7-4-9-17(20)24/h4-7,9-12H,8,13-16H2,1-3H3,(H,25,28) |
| InChIKey | CKKPBEVLYKGHEO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|