C19H20Cl2N2O2 — CID 55916150
N-[3-[(3,4-dichlorophenyl)methyl-ethylamino]-3-oxopropyl]benzamide (PubChem CID 55916150) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-[3-[(3,4-dichlorophenyl)methyl-ethylamino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[(3,4-dichlorophenyl)methyl-ethylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 55916150 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[3-[(3,4-dichlorophenyl)methyl-ethylamino]-3-oxopropyl]benzamide |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C(=O)CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-2-23(13-14-8-9-16(20)17(21)12-14)18(24)10-11-22-19(25)15-6-4-3-5-7-15/h3-9,12H,2,10-11,13H2,1H3,(H,22,25) |
| InChIKey | YEHVRHIHLIUJDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |