C17H17Cl2N3O2 — CID 9251458
N'-[2-[(3,4-dichlorophenyl)methyl-methylamino]acetyl]benzohydrazide (PubChem CID 9251458) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N'-[2-[(3,4-dichlorophenyl)methyl-methylamino]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(3,4-dichlorophenyl)methyl-methylamino]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9251458 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N'-[2-[(3,4-dichlorophenyl)methyl-methylamino]acetyl]benzohydrazide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-22(10-12-7-8-14(18)15(19)9-12)11-16(23)20-21-17(24)13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | CSVNDBSNUOOOND-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|