C16H24N4O3 — CID 8767118
2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]-methylamino]-N-tert-butylacetamide (PubChem CID 8767118) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]-methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]-methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 8767118 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[[2-(2-benzoylhydrazinyl)-2-oxoethyl]-methylamino]-N-tert-butylacetamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H24N4O3/c1-16(2,3)17-13(21)10-20(4)11-14(22)18-19-15(23)12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3,(H,17,21)(H,18,22)(H,19,23) |
| InChIKey | RZCDBCBQWUWGQY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|