methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate

C11H13Cl2NO2 — CID 60670410

IUPACmethyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate
SMILESCOC(=O)CN(C)Cc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H13Cl2NO2/c1-14(7-11(15)16-2)6-8-3-4-9(12)10(13)5-8/h3-5H,6-7H2,1-2H3
InChIKeyVDSUSMZHPVISFD-UHFFFAOYSA-N
MW262.14 g/mol
LogP2.60
Rot. Bonds4

About methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate

methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate (PubChem CID 60670410) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate
PubChem CID60670410
Molecular FormulaC11H13Cl2NO2
Molecular Weight262.14 g/mol
Exact Mass261.03
IUPAC Namemethyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate
SMILESCOC(=O)CN(C)Cc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H13Cl2NO2/c1-14(7-11(15)16-2)6-8-3-4-9(12)10(13)5-8/h3-5H,6-7H2,1-2H3
InChIKeyVDSUSMZHPVISFD-UHFFFAOYSA-N
XLogP2.60
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.14
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate?
The IUPAC name of methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate (CID 60670410) is methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate.
What is the SMILES notation for methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate?
The canonical SMILES for methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate is COC(=O)CN(C)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate?
The InChIKey is VDSUSMZHPVISFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO2/c1-14(7-11(15)16-2)6-8-3-4-9(12)10(13)5-8/h3-5H,6-7H2,1-2H3.
What are the key properties of methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate?
methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate has a molecular weight of 262.14 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate is sourced from PubChem (CID 60670410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).