C11H13Cl2NO2 — CID 60670410
methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate (PubChem CID 60670410) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate.
| Compound Name | methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate |
|---|---|
| PubChem CID | 60670410 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | methyl 2-[(3,4-dichlorophenyl)methyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO2/c1-14(7-11(15)16-2)6-8-3-4-9(12)10(13)5-8/h3-5H,6-7H2,1-2H3 |
| InChIKey | VDSUSMZHPVISFD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |