C13H17BrCl2N2O — CID 67442520
2-bromo-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]acetamide (PubChem CID 67442520) has the molecular formula C13H17BrCl2N2O and a molecular weight of 368.10 g/mol. Its IUPAC name is 2-bromo-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]acetamide.
| Compound Name | 2-bromo-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]acetamide |
|---|---|
| PubChem CID | 67442520 |
| Molecular Formula | C13H17BrCl2N2O |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-bromo-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]acetamide |
| SMILES | CN(CCCNC(=O)CBr)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17BrCl2N2O/c1-18(6-2-5-17-13(19)8-14)9-10-3-4-11(15)12(16)7-10/h3-4,7H,2,5-6,8-9H2,1H3,(H,17,19) |
| InChIKey | AIWDCRKOZCBELC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|