C15H22Cl2N2OS2 — CID 142460671
2-(3,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]acetamide (PubChem CID 142460671) has the molecular formula C15H22Cl2N2OS2 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 142460671 |
| Molecular Formula | C15H22Cl2N2OS2 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]acetamide |
| SMILES | CN(C)CCSSCCCNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2OS2/c1-19(2)7-9-22-21-8-3-6-18-15(20)11-12-4-5-13(16)14(17)10-12/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,20) |
| InChIKey | UQPBJHRCBBBOQJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|