C12H12Cl2N2O — CID 63047177
N-(3-cyanopropyl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 63047177) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is N-(3-cyanopropyl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(3-cyanopropyl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 63047177 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-(3-cyanopropyl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | N#CCCCNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O/c13-10-4-3-9(7-11(10)14)8-12(17)16-6-2-1-5-15/h3-4,7H,1-2,6,8H2,(H,16,17) |
| InChIKey | CIPZFHSWKMCQEY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|