C14H15Cl2N3O — CID 47099773
2-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 47099773) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 47099773 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NCCCn1ccnc1 |
| InChI | InChI=1S/C14H15Cl2N3O/c15-12-3-2-11(8-13(12)16)9-14(20)18-4-1-6-19-7-5-17-10-19/h2-3,5,7-8,10H,1,4,6,9H2,(H,18,20) |
| InChIKey | GRBTWCCNFGBJEI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|