C12H13ClN4O — CID 66463625
3-chloro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide (PubChem CID 66463625) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 3-chloro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66463625 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-chloro-N-(3-imidazol-1-ylpropyl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccncc1Cl |
| InChI | InChI=1S/C12H13ClN4O/c13-11-8-14-4-2-10(11)12(18)16-3-1-6-17-7-5-15-9-17/h2,4-5,7-9H,1,3,6H2,(H,16,18) |
| InChIKey | QTMZMRUBLYZQGM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|