C9H10Cl2N2O — CID 66482803
3-chloro-N-(3-chloropropyl)pyridine-4-carboxamide (PubChem CID 66482803) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 3-chloro-N-(3-chloropropyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(3-chloropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66482803 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 3-chloro-N-(3-chloropropyl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCCl)c1ccncc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c10-3-1-4-13-9(14)7-2-5-12-6-8(7)11/h2,5-6H,1,3-4H2,(H,13,14) |
| InChIKey | BSYCDAHKMNBHFM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|