C10H12BrClN2O2 — CID 114309395
N-[2-(2-bromoethoxy)ethyl]-3-chloropyridine-4-carboxamide (PubChem CID 114309395) has the molecular formula C10H12BrClN2O2 and a molecular weight of 307.57 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-3-chloropyridine-4-carboxamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114309395 |
| Molecular Formula | C10H12BrClN2O2 |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-3-chloropyridine-4-carboxamide |
| SMILES | O=C(NCCOCCBr)c1ccncc1Cl |
| InChI | InChI=1S/C10H12BrClN2O2/c11-2-5-16-6-4-14-10(15)8-1-3-13-7-9(8)12/h1,3,7H,2,4-6H2,(H,14,15) |
| InChIKey | JECUXBNWPPYWGD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|