C10H11ClN2O3S — CID 120526506
2-[2-[(3-chloropyridine-4-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 120526506) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 2-[2-[(3-chloropyridine-4-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3-chloropyridine-4-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526506 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[2-[(3-chloropyridine-4-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C10H11ClN2O3S/c11-8-5-12-2-1-7(8)10(16)13-3-4-17-6-9(14)15/h1-2,5H,3-4,6H2,(H,13,16)(H,14,15) |
| InChIKey | XDRSIWHGWNFSQD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|