C9H10ClN3OS — CID 66462619
N-(3-amino-3-sulfanylidenepropyl)-3-chloropyridine-4-carboxamide (PubChem CID 66462619) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-chloropyridine-4-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 66462619 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-chloropyridine-4-carboxamide |
| SMILES | NC(=S)CCNC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C9H10ClN3OS/c10-7-5-12-3-1-6(7)9(14)13-4-2-8(11)15/h1,3,5H,2,4H2,(H2,11,15)(H,13,14) |
| InChIKey | RBWGKGICKNFBLW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|