C11H11ClN4O — CID 66483968
3-chloro-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-4-carboxamide (PubChem CID 66483968) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is 3-chloro-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66483968 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-chloro-N-[2-(1H-imidazol-5-yl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCc1cnc[nH]1)c1ccncc1Cl |
| InChI | InChI=1S/C11H11ClN4O/c12-10-6-13-3-2-9(10)11(17)15-4-1-8-5-14-7-16-8/h2-3,5-7H,1,4H2,(H,14,16)(H,15,17) |
| InChIKey | VXTMWOJVGPEUER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |