C10H13ClN2O3 — CID 66464589
3-chloro-N-(2,2-dimethoxyethyl)pyridine-4-carboxamide (PubChem CID 66464589) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethoxyethyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(2,2-dimethoxyethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66464589 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-chloro-N-(2,2-dimethoxyethyl)pyridine-4-carboxamide |
| SMILES | COC(CNC(=O)c1ccncc1Cl)OC |
| InChI | InChI=1S/C10H13ClN2O3/c1-15-9(16-2)6-13-10(14)7-3-4-12-5-8(7)11/h3-5,9H,6H2,1-2H3,(H,13,14) |
| InChIKey | CWGGDBFAVBTNIG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|