C10H11ClN2O4 — CID 113358681
methyl 3-[(3-chloropyridine-4-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 113358681) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is methyl 3-[(3-chloropyridine-4-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-chloropyridine-4-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 113358681 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | methyl 3-[(3-chloropyridine-4-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C10H11ClN2O4/c1-17-10(16)8(14)5-13-9(15)6-2-3-12-4-7(6)11/h2-4,8,14H,5H2,1H3,(H,13,15) |
| InChIKey | KTKNQWMNGMQUHW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |