C12H11ClN2O2S — CID 103715894
3-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)pyridine-4-carboxamide (PubChem CID 103715894) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103715894 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1ccncc1Cl |
| InChI | InChI=1S/C12H11ClN2O2S/c13-10-5-14-3-1-9(10)12(17)15-6-11(16)8-2-4-18-7-8/h1-5,7,11,16H,6H2,(H,15,17) |
| InChIKey | JIHLJCSWWHHXKD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |