C18H16N2O3S — CID 111441717
N-(2-hydroxy-2-thiophen-3-ylethyl)-2-pyridin-3-yloxybenzamide (PubChem CID 111441717) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-2-pyridin-3-yloxybenzamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-pyridin-3-yloxybenzamide |
|---|---|
| PubChem CID | 111441717 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-2-pyridin-3-yloxybenzamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1ccccc1Oc1cccnc1 |
| InChI | InChI=1S/C18H16N2O3S/c21-16(13-7-9-24-12-13)11-20-18(22)15-5-1-2-6-17(15)23-14-4-3-8-19-10-14/h1-10,12,16,21H,11H2,(H,20,22) |
| InChIKey | LBSFVHVDOSUBBG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |