C21H18F2N2O4 — CID 86967156
N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-pyridin-3-yloxybenzamide (PubChem CID 86967156) has the molecular formula C21H18F2N2O4 and a molecular weight of 400.38 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-pyridin-3-yloxybenzamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-pyridin-3-yloxybenzamide |
|---|---|
| PubChem CID | 86967156 |
| Molecular Formula | C21H18F2N2O4 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-pyridin-3-yloxybenzamide |
| SMILES | O=C(NCC(O)c1ccc(OC(F)F)cc1)c1ccccc1Oc1cccnc1 |
| InChI | InChI=1S/C21H18F2N2O4/c22-21(23)29-15-9-7-14(8-10-15)18(26)13-25-20(27)17-5-1-2-6-19(17)28-16-4-3-11-24-12-16/h1-12,18,21,26H,13H2,(H,25,27) |
| InChIKey | UONKHRUQWHPTFY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |