C16H16F2N2O3 — CID 111424671
N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-6-methylpyridine-3-carboxamide (PubChem CID 111424671) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 111424671 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(O)c2ccc(OC(F)F)cc2)cn1 |
| InChI | InChI=1S/C16H16F2N2O3/c1-10-2-3-12(8-19-10)15(22)20-9-14(21)11-4-6-13(7-5-11)23-16(17)18/h2-8,14,16,21H,9H2,1H3,(H,20,22) |
| InChIKey | ZOEWPPAFURPBKK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |