C17H15F2N3O3 — CID 111424764
N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1H-indazole-7-carboxamide (PubChem CID 111424764) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1H-indazole-7-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 111424764 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1H-indazole-7-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(OC(F)F)cc1)c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C17H15F2N3O3/c18-17(19)25-12-6-4-10(5-7-12)14(23)9-20-16(24)13-3-1-2-11-8-21-22-15(11)13/h1-8,14,17,23H,9H2,(H,20,24)(H,21,22) |
| InChIKey | WPVJEYRPDHBGOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |