C11H11F4NO3 — CID 103770487
N-(3,3-difluoro-2-hydroxypropyl)-2-(difluoromethoxy)benzamide (PubChem CID 103770487) has the molecular formula C11H11F4NO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-(difluoromethoxy)benzamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 103770487 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(difluoromethoxy)benzamide |
| SMILES | O=C(NCC(O)C(F)F)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H11F4NO3/c12-9(13)7(17)5-16-10(18)6-3-1-2-4-8(6)19-11(14)15/h1-4,7,9,11,17H,5H2,(H,16,18) |
| InChIKey | KRVBZXNJGZFFPU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |