C10H11F2NO2 — CID 60644731
2-(difluoromethoxy)-N-ethylbenzamide (PubChem CID 60644731) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-ethylbenzamide.
| Compound Name | 2-(difluoromethoxy)-N-ethylbenzamide |
|---|---|
| PubChem CID | 60644731 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-(difluoromethoxy)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C10H11F2NO2/c1-2-13-9(14)7-5-3-4-6-8(7)15-10(11)12/h3-6,10H,2H2,1H3,(H,13,14) |
| InChIKey | KXKVGLULOSJQIH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |