C11H13F2NO2 — CID 60654909
2-(difluoromethoxy)-N-propylbenzamide (PubChem CID 60654909) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-propylbenzamide.
| Compound Name | 2-(difluoromethoxy)-N-propylbenzamide |
|---|---|
| PubChem CID | 60654909 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(difluoromethoxy)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H13F2NO2/c1-2-7-14-10(15)8-5-3-4-6-9(8)16-11(12)13/h3-6,11H,2,7H2,1H3,(H,14,15) |
| InChIKey | NQABBNFHPDZJSI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |