C10H9ClN2O — CID 115866885
N-but-2-ynyl-3-chloropyridine-4-carboxamide (PubChem CID 115866885) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is N-but-2-ynyl-3-chloropyridine-4-carboxamide.
| Compound Name | N-but-2-ynyl-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115866885 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | N-but-2-ynyl-3-chloropyridine-4-carboxamide |
| SMILES | CC#CCNC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C10H9ClN2O/c1-2-3-5-13-10(14)8-4-6-12-7-9(8)11/h4,6-7H,5H2,1H3,(H,13,14) |
| InChIKey | OJNJCSOERAARFW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|