C14H13ClN2O — CID 66462440
3-chloro-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide (PubChem CID 66462440) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is 3-chloro-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66462440 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-chloro-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccncc2Cl)cc1 |
| InChI | InChI=1S/C14H13ClN2O/c1-10-2-4-11(5-3-10)8-17-14(18)12-6-7-16-9-13(12)15/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | DYKOOQFNYZCQGH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |