C15H16ClN3O — CID 66482036
N-[[4-(2-aminoethyl)phenyl]methyl]-3-chloropyridine-4-carboxamide (PubChem CID 66482036) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is N-[[4-(2-aminoethyl)phenyl]methyl]-3-chloropyridine-4-carboxamide.
| Compound Name | N-[[4-(2-aminoethyl)phenyl]methyl]-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 66482036 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[[4-(2-aminoethyl)phenyl]methyl]-3-chloropyridine-4-carboxamide |
| SMILES | NCCc1ccc(CNC(=O)c2ccncc2Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3O/c16-14-10-18-8-6-13(14)15(20)19-9-12-3-1-11(2-4-12)5-7-17/h1-4,6,8,10H,5,7,9,17H2,(H,19,20) |
| InChIKey | ACJKYJBPWWNFSH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |