C13H11ClN2O2 — CID 115667770
3-chloro-N-[(2-hydroxyphenyl)methyl]pyridine-4-carboxamide (PubChem CID 115667770) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 3-chloro-N-[(2-hydroxyphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(2-hydroxyphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115667770 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-chloro-N-[(2-hydroxyphenyl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1O)c1ccncc1Cl |
| InChI | InChI=1S/C13H11ClN2O2/c14-11-8-15-6-5-10(11)13(18)16-7-9-3-1-2-4-12(9)17/h1-6,8,17H,7H2,(H,16,18) |
| InChIKey | LMMNPBQBWNDJFW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|