C13H9Cl2FN2O — CID 66484344
3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide (PubChem CID 66484344) has the molecular formula C13H9Cl2FN2O and a molecular weight of 299.13 g/mol. Its IUPAC name is 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484344 |
| Molecular Formula | C13H9Cl2FN2O |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-chloro-N-[(3-chloro-4-fluorophenyl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)c1ccncc1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O/c14-10-5-8(1-2-12(10)16)6-18-13(19)9-3-4-17-7-11(9)15/h1-5,7H,6H2,(H,18,19) |
| InChIKey | QIFVNMMCNKLFEJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |