C13H14Cl2N4O — CID 107183495
5-amino-2,3-dichloro-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 107183495) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 107183495 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C13H14Cl2N4O/c14-11-7-9(16)6-10(12(11)15)13(20)18-2-1-4-19-5-3-17-8-19/h3,5-8H,1-2,4,16H2,(H,18,20) |
| InChIKey | LOQHWLNCPATSDR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|