C10H13Cl2N3O3S — CID 107184918
5-amino-2,3-dichloro-N-(3-sulfamoylpropyl)benzamide (PubChem CID 107184918) has the molecular formula C10H13Cl2N3O3S and a molecular weight of 326.21 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(3-sulfamoylpropyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(3-sulfamoylpropyl)benzamide |
|---|---|
| PubChem CID | 107184918 |
| Molecular Formula | C10H13Cl2N3O3S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(3-sulfamoylpropyl)benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H13Cl2N3O3S/c11-8-5-6(13)4-7(9(8)12)10(16)15-2-1-3-19(14,17)18/h4-5H,1-3,13H2,(H,15,16)(H2,14,17,18) |
| InChIKey | IBYKDWJEKQQIJH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|