C10H10Cl2F2N2O2 — CID 114092848
5-amino-2,3-dichloro-N-(3,3-difluoro-2-hydroxypropyl)benzamide (PubChem CID 114092848) has the molecular formula C10H10Cl2F2N2O2 and a molecular weight of 299.10 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(3,3-difluoro-2-hydroxypropyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(3,3-difluoro-2-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 114092848 |
| Molecular Formula | C10H10Cl2F2N2O2 |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(3,3-difluoro-2-hydroxypropyl)benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCC(O)C(F)F)c1 |
| InChI | InChI=1S/C10H10Cl2F2N2O2/c11-6-2-4(15)1-5(8(6)12)10(18)16-3-7(17)9(13)14/h1-2,7,9,17H,3,15H2,(H,16,18) |
| InChIKey | MSPYTWDQJYMVIJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|