C14H11Cl2FN2O — CID 107183203
5-amino-2,3-dichloro-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 107183203) has the molecular formula C14H11Cl2FN2O and a molecular weight of 313.16 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 107183203 |
| Molecular Formula | C14H11Cl2FN2O |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCc2ccccc2F)c1 |
| InChI | InChI=1S/C14H11Cl2FN2O/c15-11-6-9(18)5-10(13(11)16)14(20)19-7-8-3-1-2-4-12(8)17/h1-6H,7,18H2,(H,19,20) |
| InChIKey | UFUIKNPSGRYARP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|