C15H14Cl2N2O2 — CID 107229457
5-amino-2,3-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide (PubChem CID 107229457) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 107229457 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCc2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-13-6-11(18)5-12(14(13)17)15(21)19-7-9-1-3-10(8-20)4-2-9/h1-6,20H,7-8,18H2,(H,19,21) |
| InChIKey | GAOUAKLZJPIIAL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|