C15H12Cl2INO2 — CID 107232664
3,5-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-iodobenzamide (PubChem CID 107232664) has the molecular formula C15H12Cl2INO2 and a molecular weight of 436.08 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 107232664 |
| Molecular Formula | C15H12Cl2INO2 |
| Molecular Weight | 436.08 g/mol |
| Exact Mass | 434.93 |
| IUPAC Name | 3,5-dichloro-N-[[4-(hydroxymethyl)phenyl]methyl]-2-iodobenzamide |
| SMILES | O=C(NCc1ccc(CO)cc1)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C15H12Cl2INO2/c16-11-5-12(14(18)13(17)6-11)15(21)19-7-9-1-3-10(8-20)4-2-9/h1-6,20H,7-8H2,(H,19,21) |
| InChIKey | YWQGWYAEZUVYBX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.08 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|