C14H10Cl2INO2 — CID 60630083
3,5-dichloro-N-[3-(hydroxymethyl)phenyl]-2-iodobenzamide (PubChem CID 60630083) has the molecular formula C14H10Cl2INO2 and a molecular weight of 422.05 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-(hydroxymethyl)phenyl]-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-[3-(hydroxymethyl)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 60630083 |
| Molecular Formula | C14H10Cl2INO2 |
| Molecular Weight | 422.05 g/mol |
| Exact Mass | 420.91 |
| IUPAC Name | 3,5-dichloro-N-[3-(hydroxymethyl)phenyl]-2-iodobenzamide |
| SMILES | O=C(Nc1cccc(CO)c1)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C14H10Cl2INO2/c15-9-5-11(13(17)12(16)6-9)14(20)18-10-3-1-2-8(4-10)7-19/h1-6,19H,7H2,(H,18,20) |
| InChIKey | AVMOXVTYWIXURZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|