C12H9Cl2NO2S — CID 103605214
2,5-dichloro-N-[3-(hydroxymethyl)phenyl]thiophene-3-carboxamide (PubChem CID 103605214) has the molecular formula C12H9Cl2NO2S and a molecular weight of 302.18 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(hydroxymethyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[3-(hydroxymethyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103605214 |
| Molecular Formula | C12H9Cl2NO2S |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2,5-dichloro-N-[3-(hydroxymethyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc(CO)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H9Cl2NO2S/c13-10-5-9(11(14)18-10)12(17)15-8-3-1-2-7(4-8)6-16/h1-5,16H,6H2,(H,15,17) |
| InChIKey | JZXSBXWQTUKMQQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |