C15H18Cl2INO2 — CID 65119535
3,5-dichloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-2-iodobenzamide (PubChem CID 65119535) has the molecular formula C15H18Cl2INO2 and a molecular weight of 442.12 g/mol. Its IUPAC name is 3,5-dichloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 65119535 |
| Molecular Formula | C15H18Cl2INO2 |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 3,5-dichloro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]-2-iodobenzamide |
| SMILES | CC1CCC(O)(CNC(=O)c2cc(Cl)cc(Cl)c2I)CC1 |
| InChI | InChI=1S/C15H18Cl2INO2/c1-9-2-4-15(21,5-3-9)8-19-14(20)11-6-10(16)7-12(17)13(11)18/h6-7,9,21H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | DKOONJLSXXBRPY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|