C15H19ClFNO2 — CID 65119892
4-chloro-2-fluoro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide (PubChem CID 65119892) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide.
| Compound Name | 4-chloro-2-fluoro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 65119892 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-chloro-2-fluoro-N-[(1-hydroxy-4-methylcyclohexyl)methyl]benzamide |
| SMILES | CC1CCC(O)(CNC(=O)c2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C15H19ClFNO2/c1-10-4-6-15(20,7-5-10)9-18-14(19)12-3-2-11(16)8-13(12)17/h2-3,8,10,20H,4-7,9H2,1H3,(H,18,19) |
| InChIKey | MBMBRAXIJPMVAQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |