C16H21ClFNO2 — CID 65123638
4-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide (PubChem CID 65123638) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 4-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 65123638 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-chloro-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide |
| SMILES | CCC1CCC(O)(CNC(=O)c2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C16H21ClFNO2/c1-2-11-5-7-16(21,8-6-11)10-19-15(20)13-4-3-12(17)9-14(13)18/h3-4,9,11,21H,2,5-8,10H2,1H3,(H,19,20) |
| InChIKey | BMHUSFXADABXMD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |