C16H23NO4 — CID 114344926
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2,3-dihydroxybenzamide (PubChem CID 114344926) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344926 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2,3-dihydroxybenzamide |
| SMILES | CCC1CCC(O)(CNC(=O)c2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C16H23NO4/c1-2-11-6-8-16(21,9-7-11)10-17-15(20)12-4-3-5-13(18)14(12)19/h3-5,11,18-19,21H,2,6-10H2,1H3,(H,17,20) |
| InChIKey | YFXJQBHFZLUBOE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|