C16H21BrFNO2 — CID 107952528
3-bromo-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide (PubChem CID 107952528) has the molecular formula C16H21BrFNO2 and a molecular weight of 358.25 g/mol. Its IUPAC name is 3-bromo-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide.
| Compound Name | 3-bromo-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 107952528 |
| Molecular Formula | C16H21BrFNO2 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-bromo-N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-fluorobenzamide |
| SMILES | CCC1CCC(O)(CNC(=O)c2cccc(Br)c2F)CC1 |
| InChI | InChI=1S/C16H21BrFNO2/c1-2-11-6-8-16(21,9-7-11)10-19-15(20)12-4-3-5-13(17)14(12)18/h3-5,11,21H,2,6-10H2,1H3,(H,19,20) |
| InChIKey | RFBTVRJJSKIBGW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |