C15H19BrFNO2 — CID 106548037
3-bromo-2-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzamide (PubChem CID 106548037) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is 3-bromo-2-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzamide.
| Compound Name | 3-bromo-2-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzamide |
|---|---|
| PubChem CID | 106548037 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3-bromo-2-fluoro-N-[(1-hydroxycycloheptyl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCCCCC1)c1cccc(Br)c1F |
| InChI | InChI=1S/C15H19BrFNO2/c16-12-7-5-6-11(13(12)17)14(19)18-10-15(20)8-3-1-2-4-9-15/h5-7,20H,1-4,8-10H2,(H,18,19) |
| InChIKey | QABJVMATKPSRLG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |