C13H13F4NO2 — CID 111859437
2-fluoro-N-[(1-hydroxycyclobutyl)methyl]-3-(trifluoromethyl)benzamide (PubChem CID 111859437) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is 2-fluoro-N-[(1-hydroxycyclobutyl)methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[(1-hydroxycyclobutyl)methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 111859437 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-fluoro-N-[(1-hydroxycyclobutyl)methyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(O)CCC1)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C13H13F4NO2/c14-10-8(3-1-4-9(10)13(15,16)17)11(19)18-7-12(20)5-2-6-12/h1,3-4,20H,2,5-7H2,(H,18,19) |
| InChIKey | UTUFINFEUNWVFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |