C13H13F4NO — CID 79885002
N-(2-cyclopropylethyl)-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 79885002) has the molecular formula C13H13F4NO and a molecular weight of 275.24 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-cyclopropylethyl)-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 79885002 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(2-cyclopropylethyl)-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCC1CC1)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C13H13F4NO/c14-11-9(2-1-3-10(11)13(15,16)17)12(19)18-7-6-8-4-5-8/h1-3,8H,4-7H2,(H,18,19) |
| InChIKey | PKSJMTJQJWSAJO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |