C11H12F4N2O3S — CID 102685069
2-fluoro-N-[2-(methylsulfamoyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 102685069) has the molecular formula C11H12F4N2O3S and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-fluoro-N-[2-(methylsulfamoyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[2-(methylsulfamoyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 102685069 |
| Molecular Formula | C11H12F4N2O3S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-fluoro-N-[2-(methylsulfamoyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C11H12F4N2O3S/c1-16-21(19,20)6-5-17-10(18)7-3-2-4-8(9(7)12)11(13,14)15/h2-4,16H,5-6H2,1H3,(H,17,18) |
| InChIKey | MEPNGTXKUFQNHM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |