C11H11F4N3O2 — CID 79885734
N-[2-(carbamoylamino)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 79885734) has the molecular formula C11H11F4N3O2 and a molecular weight of 293.22 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 79885734 |
| Molecular Formula | C11H11F4N3O2 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | NC(=O)NCCNC(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C11H11F4N3O2/c12-8-6(2-1-3-7(8)11(13,14)15)9(19)17-4-5-18-10(16)20/h1-3H,4-5H2,(H,17,19)(H3,16,18,20) |
| InChIKey | LDBVGJRZVDVEQT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|